C15H25NO3S — CID 70831485
trans-(1S,2S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 70831485) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 70831485 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | trans-(1S,2S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | CCCCC/C=C\[C@@H]1C[C@@H]1C(=O)NS(=O)(=O)C1(C)CC1 |
| InChI | InChI=1S/C15H25NO3S/c1-3-4-5-6-7-8-12-11-13(12)14(17)16-20(18,19)15(2)9-10-15/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,16,17)/b8-7-/t12-,13+/m1/s1 |
| InChIKey | QTVRAKIYFWGZOL-XRMAHGQMSA-N |
| XLogP | 2.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|