C28H42N4O5S — CID 143897432
(2S)-1-(2-anilinoacetyl)pyrrolidine-2-carboxamide;(1S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 143897432) has the molecular formula C28H42N4O5S and a molecular weight of 546.73 g/mol. Its IUPAC name is (2S)-1-(2-anilinoacetyl)pyrrolidine-2-carboxamide;(1S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | (2S)-1-(2-anilinoacetyl)pyrrolidine-2-carboxamide;(1S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143897432 |
| Molecular Formula | C28H42N4O5S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | (2S)-1-(2-anilinoacetyl)pyrrolidine-2-carboxamide;(1S)-2-[(Z)-hept-1-enyl]-N-(1-methylcyclopropyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | CCCCC/C=C\C1C[C@@H]1C(=O)NS(=O)(=O)C1(C)CC1.NC(=O)[C@@H]1CCCN1C(=O)CNc1ccccc1 |
| InChI | InChI=1S/C15H25NO3S.C13H17N3O2/c1-3-4-5-6-7-8-12-11-13(12)14(17)16-20(18,19)15(2)9-10-15;14-13(18)11-7-4-8-16(11)12(17)9-15-10-5-2-1-3-6-10/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,16,17);1-3,5-6,11,15H,4,7-9H2,(H2,14,18)/b8-7-;/t12?,13-;11-/m00/s1 |
| InChIKey | WUITZSINGQSBDO-CUKXJWPBSA-N |
| XLogP | 3.33 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|