C24H41NO3 — CID 167202384
(2R,3S)-2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 167202384) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (2R,3S)-2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3S)-2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167202384 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (2R,3S)-2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN1C(=O)C[C@H](C(=O)O)[C@H]1C |
| InChI | InChI=1S/C24H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-21(2)22(24(27)28)20-23(25)26/h7-8,10-11,21-22H,3-6,9,12-20H2,1-2H3,(H,27,28)/b8-7-,11-10-/t21-,22+/m1/s1 |
| InChIKey | JHEXMCZNMQBKRB-RHKHZDKWSA-N |
| XLogP | 6.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|