C15H28O3 — CID 70519875
carbonic acid;1,1-dimethyl-2-non-1-enylcyclopropane (PubChem CID 70519875) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is carbonic acid;1,1-dimethyl-2-non-1-enylcyclopropane.
| Compound Name | carbonic acid;1,1-dimethyl-2-non-1-enylcyclopropane |
|---|---|
| PubChem CID | 70519875 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | carbonic acid;1,1-dimethyl-2-non-1-enylcyclopropane |
| SMILES | CCCCCCCC=CC1CC1(C)C.O=C(O)O |
| InChI | InChI=1S/C14H26.CH2O3/c1-4-5-6-7-8-9-10-11-13-12-14(13,2)3;2-1(3)4/h10-11,13H,4-9,12H2,1-3H3;(H2,2,3,4) |
| InChIKey | DPZPHTMEBSAJOD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|