C19H32O4 — CID 102143482
dimethyl 2-[(E)-dodec-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 102143482) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is dimethyl 2-[(E)-dodec-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-dodec-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102143482 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | dimethyl 2-[(E)-dodec-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCCCCCCCCC/C=C/C1CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H32O4/c1-4-5-6-7-8-9-10-11-12-13-14-16-15-19(16,17(20)22-2)18(21)23-3/h13-14,16H,4-12,15H2,1-3H3/b14-13+ |
| InChIKey | FNHVQBWPGSAMCY-BUHFOSPRSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|