C11H15BrO4 — CID 102143483
dimethyl 2-[(E)-4-bromobut-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 102143483) has the molecular formula C11H15BrO4 and a molecular weight of 291.14 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-bromobut-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-4-bromobut-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102143483 |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | dimethyl 2-[(E)-4-bromobut-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1/C=C/CCBr |
| InChI | InChI=1S/C11H15BrO4/c1-15-9(13)11(10(14)16-2)7-8(11)5-3-4-6-12/h3,5,8H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | WEJCEOZOAMCOLP-HWKANZROSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|