methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate

C7H9BrF2O2 — CID 146155096

IUPACmethyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate
SMILESCOC(=O)C1(CBr)CC(F)(F)C1
InChIInChI=1S/C7H9BrF2O2/c1-12-5(11)6(4-8)2-7(9,10)3-6/h2-4H2,1H3
InChIKeySFYVOAYDKQGBFF-UHFFFAOYSA-N
MW243.05 g/mol
LogP1.97
Rot. Bonds2

About methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate

methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate (PubChem CID 146155096) has the molecular formula C7H9BrF2O2 and a molecular weight of 243.05 g/mol. Its IUPAC name is methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate
PubChem CID146155096
Molecular FormulaC7H9BrF2O2
Molecular Weight243.05 g/mol
Exact Mass241.98
IUPAC Namemethyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate
SMILESCOC(=O)C1(CBr)CC(F)(F)C1
InChIInChI=1S/C7H9BrF2O2/c1-12-5(11)6(4-8)2-7(9,10)3-6/h2-4H2,1H3
InChIKeySFYVOAYDKQGBFF-UHFFFAOYSA-N
XLogP1.97
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.05
LogP ≤ 51.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate?
The IUPAC name of methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate (CID 146155096) is methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate.
What is the SMILES notation for methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate?
The canonical SMILES for methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate is COC(=O)C1(CBr)CC(F)(F)C1.
What is the InChIKey of methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate?
The InChIKey is SFYVOAYDKQGBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF2O2/c1-12-5(11)6(4-8)2-7(9,10)3-6/h2-4H2,1H3.
What are the key properties of methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate?
methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate has a molecular weight of 243.05 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(bromomethyl)-3,3-difluorocyclobutane-1-carboxylate is sourced from PubChem (CID 146155096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).