3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid

C7H10F2O3 — CID 155943483

IUPAC3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid
SMILESCOCC1(C(=O)O)CC(F)(F)C1
InChIInChI=1S/C7H10F2O3/c1-12-4-6(5(10)11)2-7(8,9)3-6/h2-4H2,1H3,(H,10,11)
InChIKeyTUFQNTWQZKUXAF-UHFFFAOYSA-N
MW180.15 g/mol
LogP1.13
Rot. Bonds3

About 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid

3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid (PubChem CID 155943483) has the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. Its IUPAC name is 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid
PubChem CID155943483
Molecular FormulaC7H10F2O3
Molecular Weight180.15 g/mol
Exact Mass180.06
IUPAC Name3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid
SMILESCOCC1(C(=O)O)CC(F)(F)C1
InChIInChI=1S/C7H10F2O3/c1-12-4-6(5(10)11)2-7(8,9)3-6/h2-4H2,1H3,(H,10,11)
InChIKeyTUFQNTWQZKUXAF-UHFFFAOYSA-N
XLogP1.13
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.15
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid (CID 155943483) is 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid is COCC1(C(=O)O)CC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid?
The InChIKey is TUFQNTWQZKUXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O3/c1-12-4-6(5(10)11)2-7(8,9)3-6/h2-4H2,1H3,(H,10,11).
What are the key properties of 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid?
3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid has a molecular weight of 180.15 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-(methoxymethyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 155943483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).