C10H15F3O4 — CID 162567158
4-hydroxy-1-(methoxymethyl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 162567158) has the molecular formula C10H15F3O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-hydroxy-1-(methoxymethyl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-hydroxy-1-(methoxymethyl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162567158 |
| Molecular Formula | C10H15F3O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-hydroxy-1-(methoxymethyl)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | COCC1(C(=O)O)CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3O4/c1-17-6-8(7(14)15)2-4-9(16,5-3-8)10(11,12)13/h16H,2-6H2,1H3,(H,14,15) |
| InChIKey | UMISLNHUTWURNR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |