C7H12O3 — CID 66023970
1-(2-methoxyethyl)cyclopropane-1-carboxylic acid (PubChem CID 66023970) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 1-(2-methoxyethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 66023970 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 1-(2-methoxyethyl)cyclopropane-1-carboxylic acid |
| SMILES | COCCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C7H12O3/c1-10-5-4-7(2-3-7)6(8)9/h2-5H2,1H3,(H,8,9) |
| InChIKey | IJPWKHUTMBLTJD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |