C12H22O4 — CID 103181465
1-[2-(3-methoxypropoxy)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 103181465) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-(3-methoxypropoxy)ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103181465 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | COCCCOCCC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H22O4/c1-15-8-4-9-16-10-7-12(11(13)14)5-2-3-6-12/h2-10H2,1H3,(H,13,14) |
| InChIKey | WYMDQYLLLSSMRP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|