C15H28O4 — CID 103184874
4-ethyl-1-[2-(3-methoxypropoxy)ethyl]cyclohexane-1-carboxylic acid (PubChem CID 103184874) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is 4-ethyl-1-[2-(3-methoxypropoxy)ethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-[2-(3-methoxypropoxy)ethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 103184874 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-ethyl-1-[2-(3-methoxypropoxy)ethyl]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(CCOCCCOC)(C(=O)O)CC1 |
| InChI | InChI=1S/C15H28O4/c1-3-13-5-7-15(8-6-13,14(16)17)9-12-19-11-4-10-18-2/h13H,3-12H2,1-2H3,(H,16,17) |
| InChIKey | CMQCOYHUTIVQQY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|