C12H22O4S — CID 65394740
4-ethyl-1-(2-methylsulfonylethyl)cyclohexane-1-carboxylic acid (PubChem CID 65394740) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-ethyl-1-(2-methylsulfonylethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-(2-methylsulfonylethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65394740 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-ethyl-1-(2-methylsulfonylethyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(CCS(C)(=O)=O)(C(=O)O)CC1 |
| InChI | InChI=1S/C12H22O4S/c1-3-10-4-6-12(7-5-10,11(13)14)8-9-17(2,15)16/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | HPHNBXFTRWLVKY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |