C11H17F3O3 — CID 62738365
1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carboxylic acid (PubChem CID 62738365) has the molecular formula C11H17F3O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 62738365 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(CCCOCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H17F3O3/c12-11(13,14)8-17-7-3-6-10(9(15)16)4-1-2-5-10/h1-8H2,(H,15,16) |
| InChIKey | CZUHHHGPPYQVSA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|