C11H16F3NO — CID 65379316
1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carbonitrile (PubChem CID 65379316) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 65379316 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane-1-carbonitrile |
| SMILES | N#CC1(CCCOCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)9-16-7-3-6-10(8-15)4-1-2-5-10/h1-7,9H2 |
| InChIKey | CYTBHMULOLTTND-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|