C12H16F3NO2 — CID 65393991
2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile (PubChem CID 65393991) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile.
| Compound Name | 2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65393991 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1(CCCOCC(F)(F)F)CCCCC1=O |
| InChI | InChI=1S/C12H16F3NO2/c13-12(14,15)9-18-7-3-6-11(8-16)5-2-1-4-10(11)17/h1-7,9H2 |
| InChIKey | XJMOPNFNTJHJMO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|