C13H20F3NO — CID 80602622
1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclooctane-1-carbonitrile (PubChem CID 80602622) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclooctane-1-carbonitrile.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclooctane-1-carbonitrile |
|---|---|
| PubChem CID | 80602622 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclooctane-1-carbonitrile |
| SMILES | N#CC1(CCOCC(F)(F)F)CCCCCCC1 |
| InChI | InChI=1S/C13H20F3NO/c14-13(15,16)11-18-9-8-12(10-17)6-4-2-1-3-5-7-12/h1-9,11H2 |
| InChIKey | BXAURFXPQIRTTG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|