C8H11BrO4 — CID 131844843
trans-dimethyl (1S,2S)-1-(bromomethyl)cyclopropane-1,2-dicarboxylate (PubChem CID 131844843) has the molecular formula C8H11BrO4 and a molecular weight of 251.08 g/mol. Its IUPAC name is trans-dimethyl (1S,2S)-1-(bromomethyl)cyclopropane-1,2-dicarboxylate.
| Compound Name | trans-dimethyl (1S,2S)-1-(bromomethyl)cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 131844843 |
| Molecular Formula | C8H11BrO4 |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | trans-dimethyl (1S,2S)-1-(bromomethyl)cyclopropane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]1(CBr)C(=O)OC |
| InChI | InChI=1S/C8H11BrO4/c1-12-6(10)5-3-8(5,4-9)7(11)13-2/h5H,3-4H2,1-2H3/t5-,8+/m1/s1 |
| InChIKey | JVPNBDVNDIIIMF-XRGYYRRGSA-N |
| XLogP | 0.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|