C8H10O4 — CID 82598117
2-methoxycarbonylspiro[2.2]pentane-5-carboxylic acid (PubChem CID 82598117) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 2-methoxycarbonylspiro[2.2]pentane-5-carboxylic acid.
| Compound Name | 2-methoxycarbonylspiro[2.2]pentane-5-carboxylic acid |
|---|---|
| PubChem CID | 82598117 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-methoxycarbonylspiro[2.2]pentane-5-carboxylic acid |
| SMILES | COC(=O)C1CC12CC2C(=O)O |
| InChI | InChI=1S/C8H10O4/c1-12-7(11)5-3-8(5)2-4(8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10) |
| InChIKey | ORJMJCRADNZDFC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |