About methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate
methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate (PubChem CID 124705910) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate |
| PubChem CID | 124705910 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC1(OC)OC |
| InChI | InChI=1S/C8H14O4/c1-10-7(9)6-4-5-8(6,11-2)12-3/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | QJUKDAABUDTITN-LURJTMIESA-N |
| XLogP | 0.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate?
The IUPAC name of methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate (CID 124705910) is methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate.
What is the SMILES notation for methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate?
The canonical SMILES for methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate is COC(=O)[C@@H]1CCC1(OC)OC.
What is the InChIKey of methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate?
The InChIKey is QJUKDAABUDTITN-LURJTMIESA-N. The full InChI is InChI=1S/C8H14O4/c1-10-7(9)6-4-5-8(6,11-2)12-3/h6H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate?
methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate has a molecular weight of 174.20 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-2,2-dimethoxycyclobutane-1-carboxylate is sourced from PubChem (CID 124705910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).