methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate

C11H20O3 — CID 58476988

IUPACmethyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate
SMILESCOC(=O)C1CCC(C)(OC)C1(C)C
InChIInChI=1S/C11H20O3/c1-10(2)8(9(12)13-4)6-7-11(10,3)14-5/h8H,6-7H2,1-5H3
InChIKeyMQHJOVKVBNTLFA-UHFFFAOYSA-N
MW200.28 g/mol
LogP2.00
Rot. Bonds2

About methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate

methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate (PubChem CID 58476988) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate
PubChem CID58476988
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Namemethyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate
SMILESCOC(=O)C1CCC(C)(OC)C1(C)C
InChIInChI=1S/C11H20O3/c1-10(2)8(9(12)13-4)6-7-11(10,3)14-5/h8H,6-7H2,1-5H3
InChIKeyMQHJOVKVBNTLFA-UHFFFAOYSA-N
XLogP2.00
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The IUPAC name of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate (CID 58476988) is methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The canonical SMILES for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate is COC(=O)C1CCC(C)(OC)C1(C)C.
What is the InChIKey of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The InChIKey is MQHJOVKVBNTLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-10(2)8(9(12)13-4)6-7-11(10,3)14-5/h8H,6-7H2,1-5H3.
What are the key properties of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 58476988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).