About methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate
methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate (PubChem CID 58476988) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate.
Analyze methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The IUPAC name of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate (CID 58476988) is methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The canonical SMILES for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate is COC(=O)C1CCC(C)(OC)C1(C)C.
What is the InChIKey of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
The InChIKey is MQHJOVKVBNTLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-10(2)8(9(12)13-4)6-7-11(10,3)14-5/h8H,6-7H2,1-5H3.
What are the key properties of methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate?
methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxy-2,2,3-trimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 58476988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).