C13H24N2O5 — CID 173073537
N'-hydroxyethanimidamide;trans-(1S,3R)-3-methoxycarbonyl-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 173073537) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is N'-hydroxyethanimidamide;trans-(1S,3R)-3-methoxycarbonyl-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | N'-hydroxyethanimidamide;trans-(1S,3R)-3-methoxycarbonyl-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 173073537 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N'-hydroxyethanimidamide;trans-(1S,3R)-3-methoxycarbonyl-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC(N)=NO.COC(=O)[C@@H]1CC[C@](C)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C11H18O4.C2H6N2O/c1-10(2)7(8(12)15-4)5-6-11(10,3)9(13)14;1-2(3)4-5/h7H,5-6H2,1-4H3,(H,13,14);5H,1H3,(H2,3,4)/t7-,11+;/m0./s1 |
| InChIKey | FRXRDNNXCCJDNC-VNYQHEISSA-N |
| XLogP | 1.44 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|