methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate

C25H36O2 — CID 139120592

IUPACmethyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate
SMILESCOC(=O)[C@@H]1CC12C1(CCC1)C1(CCC1)C1(CCC1)C1(CCC1)C21CCC1
InChIInChI=1S/C25H36O2/c1-27-19(26)18-17-25(18)23(13-5-14-23)21(9-3-10-21)20(7-2-8-20)22(11-4-12-22)24(25)15-6-16-24/h18H,2-17H2,1H3/t18-/m0/s1
InChIKeyIRDVBMVOWHHRBZ-SFHVURJKSA-N
MW368.56 g/mol
LogP6.03
Rot. Bonds1

About methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate

methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate (PubChem CID 139120592) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate.

Molecular Properties

Compound Namemethyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate
PubChem CID139120592
Molecular FormulaC25H36O2
Molecular Weight368.56 g/mol
Exact Mass368.27
IUPAC Namemethyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate
SMILESCOC(=O)[C@@H]1CC12C1(CCC1)C1(CCC1)C1(CCC1)C1(CCC1)C21CCC1
InChIInChI=1S/C25H36O2/c1-27-19(26)18-17-25(18)23(13-5-14-23)21(9-3-10-21)20(7-2-8-20)22(11-4-12-22)24(25)15-6-16-24/h18H,2-17H2,1H3/t18-/m0/s1
InChIKeyIRDVBMVOWHHRBZ-SFHVURJKSA-N
XLogP6.03
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.56
LogP ≤ 56.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate?
The IUPAC name of methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate (CID 139120592) is methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate.
What is the SMILES notation for methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate?
The canonical SMILES for methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate is COC(=O)[C@@H]1CC12C1(CCC1)C1(CCC1)C1(CCC1)C1(CCC1)C21CCC1.
What is the InChIKey of methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate?
The InChIKey is IRDVBMVOWHHRBZ-SFHVURJKSA-N. The full InChI is InChI=1S/C25H36O2/c1-27-19(26)18-17-25(18)23(13-5-14-23)21(9-3-10-21)20(7-2-8-20)22(11-4-12-22)24(25)15-6-16-24/h18H,2-17H2,1H3/t18-/m0/s1.
What are the key properties of methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate?
methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate has a molecular weight of 368.56 g/mol, XLogP of 6.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-hexaspiro[2.0.34.0.38.0.312.0.316.0.320.03]tricosane-1-carboxylate is sourced from PubChem (CID 139120592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).