C38H75NO — CID 174851085
(Z)-N,N-dimethyloctadec-9-enamide;1,1-dimethyl-2-tridecylcyclopropane (PubChem CID 174851085) has the molecular formula C38H75NO and a molecular weight of 562.02 g/mol. Its IUPAC name is (Z)-N,N-dimethyloctadec-9-enamide;1,1-dimethyl-2-tridecylcyclopropane.
| Compound Name | (Z)-N,N-dimethyloctadec-9-enamide;1,1-dimethyl-2-tridecylcyclopropane |
|---|---|
| PubChem CID | 174851085 |
| Molecular Formula | C38H75NO |
| Molecular Weight | 562.02 g/mol |
| Exact Mass | 561.58 |
| IUPAC Name | (Z)-N,N-dimethyloctadec-9-enamide;1,1-dimethyl-2-tridecylcyclopropane |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)C.CCCCCCCCCCCCCC1CC1(C)C |
| InChI | InChI=1S/C20H39NO.C18H36/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21(2)3;1-4-5-6-7-8-9-10-11-12-13-14-15-17-16-18(17,2)3/h11-12H,4-10,13-19H2,1-3H3;17H,4-16H2,1-3H3/b12-11-; |
| InChIKey | MUXCXTQWLSYUBU-AFEZEDKISA-N |
| XLogP | 12.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.02 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|