C12H18 — CID 178103964
[(2Z,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]cyclopropane (PubChem CID 178103964) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is [(2Z,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]cyclopropane.
| Compound Name | [(2Z,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]cyclopropane |
|---|---|
| PubChem CID | 178103964 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | [(2Z,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]cyclopropane |
| SMILES | C/C=C\C=C/C(C)=C(/C)C1CC1 |
| InChI | InChI=1S/C12H18/c1-4-5-6-7-10(2)11(3)12-8-9-12/h4-7,12H,8-9H2,1-3H3/b5-4-,7-6-,11-10- |
| InChIKey | SQPBOPVDWODOJC-DZRQJSDLSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|