C18H24O4 — CID 74220898
[4-[(2E,4E)-hexa-2,4-dienoyl]oxycyclohexyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 74220898) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [4-[(2E,4E)-hexa-2,4-dienoyl]oxycyclohexyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [4-[(2E,4E)-hexa-2,4-dienoyl]oxycyclohexyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 74220898 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [4-[(2E,4E)-hexa-2,4-dienoyl]oxycyclohexyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC1CCC(OC(=O)/C=C/C=C/C)CC1 |
| InChI | InChI=1S/C18H24O4/c1-3-5-7-9-17(19)21-15-11-13-16(14-12-15)22-18(20)10-8-6-4-2/h3-10,15-16H,11-14H2,1-2H3/b5-3+,6-4+,9-7+,10-8+ |
| InChIKey | HDOHDVPTVMFEEX-MIIZMDLZSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|