C6H9KO3 — CID 174428854
potassium;(2E,4E)-hexa-2,4-dieneperoxoic acid;hydride (PubChem CID 174428854) has the molecular formula C6H9KO3 and a molecular weight of 168.23 g/mol. Its IUPAC name is potassium;(2E,4E)-hexa-2,4-dieneperoxoic acid;hydride.
| Compound Name | potassium;(2E,4E)-hexa-2,4-dieneperoxoic acid;hydride |
|---|---|
| PubChem CID | 174428854 |
| Molecular Formula | C6H9KO3 |
| Molecular Weight | 168.23 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | potassium;(2E,4E)-hexa-2,4-dieneperoxoic acid;hydride |
| SMILES | C/C=C/C=C/C(=O)OO.[H-].[K+] |
| InChI | InChI=1S/C6H8O3.K.H/c1-2-3-4-5-6(7)9-8;;/h2-5,8H,1H3;;/q;+1;-1/b3-2+,5-4+;; |
| InChIKey | UGAXKSJAXKHJDH-IOUXFWSCSA-N |
| XLogP | -1.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.23 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|