C7H8CeO4 — CID 175593072
carboxy (2E,4E)-hexa-2,4-dienoate;cerium (PubChem CID 175593072) has the molecular formula C7H8CeO4 and a molecular weight of 296.25 g/mol. Its IUPAC name is carboxy (2E,4E)-hexa-2,4-dienoate;cerium.
| Compound Name | carboxy (2E,4E)-hexa-2,4-dienoate;cerium |
|---|---|
| PubChem CID | 175593072 |
| Molecular Formula | C7H8CeO4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | carboxy (2E,4E)-hexa-2,4-dienoate;cerium |
| SMILES | C/C=C/C=C/C(=O)OC(=O)O.[Ce] |
| InChI | InChI=1S/C7H8O4.Ce/c1-2-3-4-5-6(8)11-7(9)10;/h2-5H,1H3,(H,9,10);/b3-2+,5-4+; |
| InChIKey | RRZMSRVSWJTJIW-STWYSWDKSA-N |
| XLogP | 1.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|