C16H20O4 — CID 74221225
[4-[(2E)-penta-2,4-dienoyl]oxycyclohexyl] (2E)-penta-2,4-dienoate (PubChem CID 74221225) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [4-[(2E)-penta-2,4-dienoyl]oxycyclohexyl] (2E)-penta-2,4-dienoate.
| Compound Name | [4-[(2E)-penta-2,4-dienoyl]oxycyclohexyl] (2E)-penta-2,4-dienoate |
|---|---|
| PubChem CID | 74221225 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [4-[(2E)-penta-2,4-dienoyl]oxycyclohexyl] (2E)-penta-2,4-dienoate |
| SMILES | C=C/C=C/C(=O)OC1CCC(OC(=O)/C=C/C=C)CC1 |
| InChI | InChI=1S/C16H20O4/c1-3-5-7-15(17)19-13-9-11-14(12-10-13)20-16(18)8-6-4-2/h3-8,13-14H,1-2,9-12H2/b7-5+,8-6+ |
| InChIKey | UYGKTDXTWNLJIZ-KQQUZDAGSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|