C23H32O3 — CID 54226465
[4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl] but-2-enoate (PubChem CID 54226465) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl] but-2-enoate.
| Compound Name | [4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl] but-2-enoate |
|---|---|
| PubChem CID | 54226465 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl] but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC(C2CCC(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H32O3/c1-3-4-23(24)26-22-15-11-20(12-16-22)18-7-5-17(6-8-18)19-9-13-21(25-2)14-10-19/h3-4,9-10,13-14,17-18,20,22H,5-8,11-12,15-16H2,1-2H3 |
| InChIKey | QGFABFFPAMBEPP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|