C27H38O4 — CID 18658290
(4-butylphenyl) 4-[4-[(E)-but-2-enoyl]oxycyclohexyl]cyclohexane-1-carboxylate (PubChem CID 18658290) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is (4-butylphenyl) 4-[4-[(E)-but-2-enoyl]oxycyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | (4-butylphenyl) 4-[4-[(E)-but-2-enoyl]oxycyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18658290 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (4-butylphenyl) 4-[4-[(E)-but-2-enoyl]oxycyclohexyl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/C(=O)OC1CCC(C2CCC(C(=O)Oc3ccc(CCCC)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H38O4/c1-3-5-7-20-8-16-25(17-9-20)31-27(29)23-12-10-21(11-13-23)22-14-18-24(19-15-22)30-26(28)6-4-2/h4,6,8-9,16-17,21-24H,3,5,7,10-15,18-19H2,1-2H3/b6-4+ |
| InChIKey | XDBFGESKAAXSPY-GQCTYLIASA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|