C23H36N2 — CID 143721814
(3E,5Z,7Z)-3-(1-cyclopropylethylideneamino)-N-[(1-ethylcyclopentyl)methyl]-4-methylnona-1,3,5,7-tetraen-2-amine (PubChem CID 143721814) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is (3E,5Z,7Z)-3-(1-cyclopropylethylideneamino)-N-[(1-ethylcyclopentyl)methyl]-4-methylnona-1,3,5,7-tetraen-2-amine.
| Compound Name | (3E,5Z,7Z)-3-(1-cyclopropylethylideneamino)-N-[(1-ethylcyclopentyl)methyl]-4-methylnona-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 143721814 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (3E,5Z,7Z)-3-(1-cyclopropylethylideneamino)-N-[(1-ethylcyclopentyl)methyl]-4-methylnona-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(NCC1(CC)CCCC1)C(/N=C(\C)C1CC1)=C(C)\C=C/C=C\C |
| InChI | InChI=1S/C23H36N2/c1-6-8-9-12-18(3)22(25-19(4)21-13-14-21)20(5)24-17-23(7-2)15-10-11-16-23/h6,8-9,12,21,24H,5,7,10-11,13-17H2,1-4H3/b8-6-,12-9-,22-18+,25-19+ |
| InChIKey | WRKMSLNFZDIWRW-RPPBQCTRSA-N |
| XLogP | 6.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|