About 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde
1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde (PubChem CID 143085262) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde.
Molecular Properties
| Compound Name | 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde |
| PubChem CID | 143085262 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde |
| SMILES | C=O.CCC1(CNC)CCCCC1 |
| InChI | InChI=1S/C10H21N.CH2O/c1-3-10(9-11-2)7-5-4-6-8-10;1-2/h11H,3-9H2,1-2H3;1H2 |
| InChIKey | QGQUFTTUNMQUGL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde?
The IUPAC name of 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde (CID 143085262) is 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde.
What is the SMILES notation for 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde?
The canonical SMILES for 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde is C=O.CCC1(CNC)CCCCC1.
What is the InChIKey of 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde?
The InChIKey is QGQUFTTUNMQUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.CH2O/c1-3-10(9-11-2)7-5-4-6-8-10;1-2/h11H,3-9H2,1-2H3;1H2.
What are the key properties of 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde?
1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde has a molecular weight of 185.31 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylcyclohexyl)-N-methylmethanamine;formaldehyde is sourced from PubChem (CID 143085262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).