C12H26 — CID 142116480
1,1-diethylcyclohexane;ethane (PubChem CID 142116480) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is 1,1-diethylcyclohexane;ethane.
| Compound Name | 1,1-diethylcyclohexane;ethane |
|---|---|
| PubChem CID | 142116480 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 1,1-diethylcyclohexane;ethane |
| SMILES | CC.CCC1(CC)CCCCC1 |
| InChI | InChI=1S/C10H20.C2H6/c1-3-10(4-2)8-6-5-7-9-10;1-2/h3-9H2,1-2H3;1-2H3 |
| InChIKey | SDWFHLAVWIAICZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |