C15H32O — CID 144653602
ethane;methoxymethane;(2Z,4Z,6Z)-3-methylocta-2,4,6-triene (PubChem CID 144653602) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;methoxymethane;(2Z,4Z,6Z)-3-methylocta-2,4,6-triene.
| Compound Name | ethane;methoxymethane;(2Z,4Z,6Z)-3-methylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144653602 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | ethane;methoxymethane;(2Z,4Z,6Z)-3-methylocta-2,4,6-triene |
| SMILES | C/C=C\C=C/C(C)=C\C.CC.CC.COC |
| InChI | InChI=1S/C9H14.C2H6O.2C2H6/c1-4-6-7-8-9(3)5-2;1-3-2;2*1-2/h4-8H,1-3H3;1-2H3;2*1-2H3/b6-4-,8-7-,9-5-;;; |
| InChIKey | LPHKBFVAPUXZRE-NWXITFCZSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|