C9H13NO — CID 141023741
3-methylocta-2,4,6-trienamide (PubChem CID 141023741) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methylocta-2,4,6-trienamide.
| Compound Name | 3-methylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 141023741 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-methylocta-2,4,6-trienamide |
| SMILES | CC=CC=CC(C)=CC(N)=O |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-6-8(2)7-9(10)11/h3-7H,1-2H3,(H2,10,11) |
| InChIKey | NDXGJFNBTPOARI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|