About (2E,4E)-hexa-2,4-dienamide;phosphane
(2E,4E)-hexa-2,4-dienamide;phosphane (PubChem CID 175915492) has the molecular formula C6H12NOP
and a molecular weight of 145.14 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienamide;phosphane.
Molecular Properties
| Compound Name | (2E,4E)-hexa-2,4-dienamide;phosphane |
| PubChem CID | 175915492 |
| Molecular Formula | C6H12NOP |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienamide;phosphane |
| SMILES | C/C=C/C=C/C(N)=O.P |
| InChI | InChI=1S/C6H9NO.H3P/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H2,7,8);1H3/b3-2+,5-4+; |
| InChIKey | CMQNCPAQISLEOA-STWYSWDKSA-N |
| XLogP | 0.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-hexa-2,4-dienamide;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-hexa-2,4-dienamide;phosphane?
The IUPAC name of (2E,4E)-hexa-2,4-dienamide;phosphane (CID 175915492) is (2E,4E)-hexa-2,4-dienamide;phosphane.
What is the SMILES notation for (2E,4E)-hexa-2,4-dienamide;phosphane?
The canonical SMILES for (2E,4E)-hexa-2,4-dienamide;phosphane is C/C=C/C=C/C(N)=O.P.
What is the InChIKey of (2E,4E)-hexa-2,4-dienamide;phosphane?
The InChIKey is CMQNCPAQISLEOA-STWYSWDKSA-N. The full InChI is InChI=1S/C6H9NO.H3P/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H2,7,8);1H3/b3-2+,5-4+;.
What are the key properties of (2E,4E)-hexa-2,4-dienamide;phosphane?
(2E,4E)-hexa-2,4-dienamide;phosphane has a molecular weight of 145.14 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-hexa-2,4-dienamide;phosphane is sourced from PubChem (CID 175915492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).