About (Z)-but-2-enamide;(E)-but-2-enamide;methane
(Z)-but-2-enamide;(E)-but-2-enamide;methane (PubChem CID 163931576) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-but-2-enamide;(E)-but-2-enamide;methane.
Molecular Properties
| Compound Name | (Z)-but-2-enamide;(E)-but-2-enamide;methane |
| PubChem CID | 163931576 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (Z)-but-2-enamide;(E)-but-2-enamide;methane |
| SMILES | C.C/C=C/C(N)=O.C/C=C\C(N)=O |
| InChI | InChI=1S/2C4H7NO.CH4/c2*1-2-3-4(5)6;/h2*2-3H,1H3,(H2,5,6);1H4/b3-2+;3-2-; |
| InChIKey | RJCFSYIUTLOUJT-OLIZGRGESA-N |
| XLogP | 0.73 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enamide;(E)-but-2-enamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enamide;(E)-but-2-enamide;methane?
The IUPAC name of (Z)-but-2-enamide;(E)-but-2-enamide;methane (CID 163931576) is (Z)-but-2-enamide;(E)-but-2-enamide;methane.
What is the SMILES notation for (Z)-but-2-enamide;(E)-but-2-enamide;methane?
The canonical SMILES for (Z)-but-2-enamide;(E)-but-2-enamide;methane is C.C/C=C/C(N)=O.C/C=C\C(N)=O.
What is the InChIKey of (Z)-but-2-enamide;(E)-but-2-enamide;methane?
The InChIKey is RJCFSYIUTLOUJT-OLIZGRGESA-N. The full InChI is InChI=1S/2C4H7NO.CH4/c2*1-2-3-4(5)6;/h2*2-3H,1H3,(H2,5,6);1H4/b3-2+;3-2-;.
What are the key properties of (Z)-but-2-enamide;(E)-but-2-enamide;methane?
(Z)-but-2-enamide;(E)-but-2-enamide;methane has a molecular weight of 186.25 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enamide;(E)-but-2-enamide;methane is sourced from PubChem (CID 163931576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).