C6H9NO — CID 143438957
(1Z,4Z)-1-aminohexa-1,4-dien-3-one (PubChem CID 143438957) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is (1Z,4Z)-1-aminohexa-1,4-dien-3-one.
| Compound Name | (1Z,4Z)-1-aminohexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 143438957 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (1Z,4Z)-1-aminohexa-1,4-dien-3-one |
| SMILES | C/C=C\C(=O)/C=C\N |
| InChI | InChI=1S/C6H9NO/c1-2-3-6(8)4-5-7/h2-5H,7H2,1H3/b3-2-,5-4- |
| InChIKey | UJSZHMDHVUGUJX-LDIADDGTSA-N |
| XLogP | 0.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|