About (E)-but-2-enamide;ethane
(E)-but-2-enamide;ethane (PubChem CID 145356551) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is (E)-but-2-enamide;ethane.
Molecular Properties
| Compound Name | (E)-but-2-enamide;ethane |
| PubChem CID | 145356551 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (E)-but-2-enamide;ethane |
| SMILES | C/C=C/C(N)=O.CC.CC |
| InChI | InChI=1S/C4H7NO.2C2H6/c1-2-3-4(5)6;2*1-2/h2-3H,1H3,(H2,5,6);2*1-2H3/b3-2+;; |
| InChIKey | KHQSNNQSQVGZAI-WTVBWJGASA-N |
| XLogP | 2.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enamide;ethane?
The IUPAC name of (E)-but-2-enamide;ethane (CID 145356551) is (E)-but-2-enamide;ethane.
What is the SMILES notation for (E)-but-2-enamide;ethane?
The canonical SMILES for (E)-but-2-enamide;ethane is C/C=C/C(N)=O.CC.CC.
What is the InChIKey of (E)-but-2-enamide;ethane?
The InChIKey is KHQSNNQSQVGZAI-WTVBWJGASA-N. The full InChI is InChI=1S/C4H7NO.2C2H6/c1-2-3-4(5)6;2*1-2/h2-3H,1H3,(H2,5,6);2*1-2H3/b3-2+;;.
What are the key properties of (E)-but-2-enamide;ethane?
(E)-but-2-enamide;ethane has a molecular weight of 145.25 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enamide;ethane is sourced from PubChem (CID 145356551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).