About (E)-4-bromobut-2-enamide;ethane
(E)-4-bromobut-2-enamide;ethane (PubChem CID 145199796) has the molecular formula C6H12BrNO
and a molecular weight of 194.07 g/mol. Its IUPAC name is (E)-4-bromobut-2-enamide;ethane.
Molecular Properties
| Compound Name | (E)-4-bromobut-2-enamide;ethane |
| PubChem CID | 145199796 |
| Molecular Formula | C6H12BrNO |
| Molecular Weight | 194.07 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | (E)-4-bromobut-2-enamide;ethane |
| SMILES | CC.NC(=O)/C=C/CBr |
| InChI | InChI=1S/C4H6BrNO.C2H6/c5-3-1-2-4(6)7;1-2/h1-2H,3H2,(H2,6,7);1-2H3/b2-1+; |
| InChIKey | TWQXULOUJMNVPE-TYYBGVCCSA-N |
| XLogP | 1.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.07 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-bromobut-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-bromobut-2-enamide;ethane?
The IUPAC name of (E)-4-bromobut-2-enamide;ethane (CID 145199796) is (E)-4-bromobut-2-enamide;ethane.
What is the SMILES notation for (E)-4-bromobut-2-enamide;ethane?
The canonical SMILES for (E)-4-bromobut-2-enamide;ethane is CC.NC(=O)/C=C/CBr.
What is the InChIKey of (E)-4-bromobut-2-enamide;ethane?
The InChIKey is TWQXULOUJMNVPE-TYYBGVCCSA-N. The full InChI is InChI=1S/C4H6BrNO.C2H6/c5-3-1-2-4(6)7;1-2/h1-2H,3H2,(H2,6,7);1-2H3/b2-1+;.
What are the key properties of (E)-4-bromobut-2-enamide;ethane?
(E)-4-bromobut-2-enamide;ethane has a molecular weight of 194.07 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-bromobut-2-enamide;ethane is sourced from PubChem (CID 145199796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).