About 5-oxohex-2-enamide
5-oxohex-2-enamide (PubChem CID 53395079) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-oxohex-2-enamide.
Molecular Properties
| Compound Name | 5-oxohex-2-enamide |
| PubChem CID | 53395079 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-oxohex-2-enamide |
| SMILES | CC(=O)CC=CC(N)=O |
| InChI | InChI=1S/C6H9NO2/c1-5(8)3-2-4-6(7)9/h2,4H,3H2,1H3,(H2,7,9) |
| InChIKey | PNRGFGRTVZRASG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-oxohex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxohex-2-enamide?
The IUPAC name of 5-oxohex-2-enamide (CID 53395079) is 5-oxohex-2-enamide.
What is the SMILES notation for 5-oxohex-2-enamide?
The canonical SMILES for 5-oxohex-2-enamide is CC(=O)CC=CC(N)=O.
What is the InChIKey of 5-oxohex-2-enamide?
The InChIKey is PNRGFGRTVZRASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-5(8)3-2-4-6(7)9/h2,4H,3H2,1H3,(H2,7,9).
What are the key properties of 5-oxohex-2-enamide?
5-oxohex-2-enamide has a molecular weight of 127.14 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxohex-2-enamide is sourced from PubChem (CID 53395079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).