About (E)-4-(dimethylamino)but-2-enamide;methane
(E)-4-(dimethylamino)but-2-enamide;methane (PubChem CID 155781638) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-2-enamide;methane.
Molecular Properties
| Compound Name | (E)-4-(dimethylamino)but-2-enamide;methane |
| PubChem CID | 155781638 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (E)-4-(dimethylamino)but-2-enamide;methane |
| SMILES | C.CN(C)C/C=C/C(N)=O |
| InChI | InChI=1S/C6H12N2O.CH4/c1-8(2)5-3-4-6(7)9;/h3-4H,5H2,1-2H3,(H2,7,9);1H4/b4-3+; |
| InChIKey | KGUZJHZYRSRZSS-BJILWQEISA-N |
| XLogP | 0.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(dimethylamino)but-2-enamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(dimethylamino)but-2-enamide;methane?
The IUPAC name of (E)-4-(dimethylamino)but-2-enamide;methane (CID 155781638) is (E)-4-(dimethylamino)but-2-enamide;methane.
What is the SMILES notation for (E)-4-(dimethylamino)but-2-enamide;methane?
The canonical SMILES for (E)-4-(dimethylamino)but-2-enamide;methane is C.CN(C)C/C=C/C(N)=O.
What is the InChIKey of (E)-4-(dimethylamino)but-2-enamide;methane?
The InChIKey is KGUZJHZYRSRZSS-BJILWQEISA-N. The full InChI is InChI=1S/C6H12N2O.CH4/c1-8(2)5-3-4-6(7)9;/h3-4H,5H2,1-2H3,(H2,7,9);1H4/b4-3+;.
What are the key properties of (E)-4-(dimethylamino)but-2-enamide;methane?
(E)-4-(dimethylamino)but-2-enamide;methane has a molecular weight of 144.22 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(dimethylamino)but-2-enamide;methane is sourced from PubChem (CID 155781638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).