C13H26N4O — CID 142279034
acetylene;(E)-4-(dimethylamino)but-2-enamide;(3S)-N-methylpyrrolidin-3-amine (PubChem CID 142279034) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is acetylene;(E)-4-(dimethylamino)but-2-enamide;(3S)-N-methylpyrrolidin-3-amine.
| Compound Name | acetylene;(E)-4-(dimethylamino)but-2-enamide;(3S)-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 142279034 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | acetylene;(E)-4-(dimethylamino)but-2-enamide;(3S)-N-methylpyrrolidin-3-amine |
| SMILES | C#C.CN(C)C/C=C/C(N)=O.CN[C@H]1CCNC1 |
| InChI | InChI=1S/C6H12N2O.C5H12N2.C2H2/c1-8(2)5-3-4-6(7)9;1-6-5-2-3-7-4-5;1-2/h3-4H,5H2,1-2H3,(H2,7,9);5-7H,2-4H2,1H3;1-2H/b4-3+;;/t;5-;/m.0./s1 |
| InChIKey | FALXSMKIYYMLTN-ZWFCZDMUSA-N |
| XLogP | -0.59 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|