C11H22N4O — CID 134219753
(E)-4-(dimethylamino)-N-[(4R)-4-(methylamino)pyrrolidin-3-yl]but-2-enamide (PubChem CID 134219753) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[(4R)-4-(methylamino)pyrrolidin-3-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[(4R)-4-(methylamino)pyrrolidin-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 134219753 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[(4R)-4-(methylamino)pyrrolidin-3-yl]but-2-enamide |
| SMILES | CN[C@@H]1CNCC1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C11H22N4O/c1-12-9-7-13-8-10(9)14-11(16)5-4-6-15(2)3/h4-5,9-10,12-13H,6-8H2,1-3H3,(H,14,16)/b5-4+/t9-,10?/m1/s1 |
| InChIKey | QDDQIHYAZCPUER-QVVGBKBVSA-N |
| XLogP | -1.22 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|