C11H22N4O — CID 178118707
(E)-N-[[1-(aminomethyl)azetidin-3-yl]methyl]-4-(dimethylamino)but-2-enamide (PubChem CID 178118707) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-N-[[1-(aminomethyl)azetidin-3-yl]methyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[[1-(aminomethyl)azetidin-3-yl]methyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 178118707 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (E)-N-[[1-(aminomethyl)azetidin-3-yl]methyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)NCC1CN(CN)C1 |
| InChI | InChI=1S/C11H22N4O/c1-14(2)5-3-4-11(16)13-6-10-7-15(8-10)9-12/h3-4,10H,5-9,12H2,1-2H3,(H,13,16)/b4-3+ |
| InChIKey | XREWHKDSYBMLFE-ONEGZZNKSA-N |
| XLogP | -0.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|