C10H15N3O — CID 138042751
1-[(E)-4-(dimethylamino)but-2-enoyl]azetidine-3-carbonitrile (PubChem CID 138042751) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-[(E)-4-(dimethylamino)but-2-enoyl]azetidine-3-carbonitrile.
| Compound Name | 1-[(E)-4-(dimethylamino)but-2-enoyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 138042751 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-[(E)-4-(dimethylamino)but-2-enoyl]azetidine-3-carbonitrile |
| SMILES | CN(C)C/C=C/C(=O)N1CC(C#N)C1 |
| InChI | InChI=1S/C10H15N3O/c1-12(2)5-3-4-10(14)13-7-9(6-11)8-13/h3-4,9H,5,7-8H2,1-2H3/b4-3+ |
| InChIKey | QYIZLEAAMHXZAJ-ONEGZZNKSA-N |
| XLogP | 0.09 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|