C12H19LiN2O3 — CID 142547771
lithium 1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxylate (PubChem CID 142547771) has the molecular formula C12H19LiN2O3 and a molecular weight of 246.24 g/mol. Its IUPAC name is lithium 1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxylate.
| Compound Name | lithium 1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 142547771 |
| Molecular Formula | C12H19LiN2O3 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | lithium 1-[(E)-4-(dimethylamino)but-2-enoyl]piperidine-4-carboxylate |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(C(=O)[O-])CC1.[Li+] |
| InChI | InChI=1S/C12H20N2O3.Li/c1-13(2)7-3-4-11(15)14-8-5-10(6-9-14)12(16)17;/h3-4,10H,5-9H2,1-2H3,(H,16,17);/q;+1/p-1/b4-3+; |
| InChIKey | VYFOAWQBYBFLOR-BJILWQEISA-M |
| XLogP | -3.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|