C18H31N3O — CID 129306632
(E)-1-(2-cyclohexyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(dimethylamino)but-2-en-1-one (PubChem CID 129306632) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (E)-1-(2-cyclohexyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-(2-cyclohexyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 129306632 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (E)-1-(2-cyclohexyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCC2(C1)CN(C1CCCCC1)C2 |
| InChI | InChI=1S/C18H31N3O/c1-19(2)11-6-9-17(22)20-12-10-18(13-20)14-21(15-18)16-7-4-3-5-8-16/h6,9,16H,3-5,7-8,10-15H2,1-2H3/b9-6+ |
| InChIKey | RHIQAKVHYZVQKZ-RMKNXTFCSA-N |
| XLogP | 1.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|