About ethane;methane;(E)-pent-3-en-2-one
ethane;methane;(E)-pent-3-en-2-one (PubChem CID 157296022) has the molecular formula C11H28O
and a molecular weight of 176.34 g/mol. Its IUPAC name is ethane;methane;(E)-pent-3-en-2-one.
Molecular Properties
| Compound Name | ethane;methane;(E)-pent-3-en-2-one |
| PubChem CID | 157296022 |
| Molecular Formula | C11H28O |
| Molecular Weight | 176.34 g/mol |
| Exact Mass | 176.21 |
| IUPAC Name | ethane;methane;(E)-pent-3-en-2-one |
| SMILES | C.C.C/C=C/C(C)=O.CC.CC |
| InChI | InChI=1S/C5H8O.2C2H6.2CH4/c1-3-4-5(2)6;2*1-2;;/h3-4H,1-2H3;2*1-2H3;2*1H4/b4-3+;;;; |
| InChIKey | BBIVGGUWZYBUEV-PLJHVDPMSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;(E)-pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(E)-pent-3-en-2-one?
The IUPAC name of ethane;methane;(E)-pent-3-en-2-one (CID 157296022) is ethane;methane;(E)-pent-3-en-2-one.
What is the SMILES notation for ethane;methane;(E)-pent-3-en-2-one?
The canonical SMILES for ethane;methane;(E)-pent-3-en-2-one is C.C.C/C=C/C(C)=O.CC.CC.
What is the InChIKey of ethane;methane;(E)-pent-3-en-2-one?
The InChIKey is BBIVGGUWZYBUEV-PLJHVDPMSA-N. The full InChI is InChI=1S/C5H8O.2C2H6.2CH4/c1-3-4-5(2)6;2*1-2;;/h3-4H,1-2H3;2*1-2H3;2*1H4/b4-3+;;;;.
What are the key properties of ethane;methane;(E)-pent-3-en-2-one?
ethane;methane;(E)-pent-3-en-2-one has a molecular weight of 176.34 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(E)-pent-3-en-2-one is sourced from PubChem (CID 157296022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).